C10H19NO — CID 65392442
methyl 4,4-dimethylcyclohexane-1-carboximidate (PubChem CID 65392442) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is methyl 4,4-dimethylcyclohexane-1-carboximidate.
| Compound Name | methyl 4,4-dimethylcyclohexane-1-carboximidate |
|---|---|
| PubChem CID | 65392442 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | methyl 4,4-dimethylcyclohexane-1-carboximidate |
| SMILES | [H]/N=C(\OC)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C10H19NO/c1-10(2)6-4-8(5-7-10)9(11)12-3/h8,11H,4-7H2,1-3H3/b11-9- |
| InChIKey | NERXHBDCDPKTGJ-LUAWRHEFSA-N |
| XLogP | 2.83 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|