C15H19BrO2 — CID 65392622
1-[(4-bromophenyl)methyl]-3-methylcyclohexane-1-carboxylic acid (PubChem CID 65392622) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65392622 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(Cc2ccc(Br)cc2)(C(=O)O)C1 |
| InChI | InChI=1S/C15H19BrO2/c1-11-3-2-8-15(9-11,14(17)18)10-12-4-6-13(16)7-5-12/h4-7,11H,2-3,8-10H2,1H3,(H,17,18) |
| InChIKey | FUJZLSHWTVQELG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |