C15H21NO2 — CID 79425636
3-methyl-1-(2-pyridin-4-ylethyl)cyclohexane-1-carboxylic acid (PubChem CID 79425636) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-methyl-1-(2-pyridin-4-ylethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-1-(2-pyridin-4-ylethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79425636 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 3-methyl-1-(2-pyridin-4-ylethyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(CCc2ccncc2)(C(=O)O)C1 |
| InChI | InChI=1S/C15H21NO2/c1-12-3-2-7-15(11-12,14(17)18)8-4-13-5-9-16-10-6-13/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H,17,18) |
| InChIKey | OMVXVBAQSPOLFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |