C12H13NOS — CID 65392739
2-(thiophen-2-ylmethyl)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile (PubChem CID 65392739) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethyl)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile.
| Compound Name | 2-(thiophen-2-ylmethyl)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 65392739 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-(thiophen-2-ylmethyl)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile |
| SMILES | N#CC1(Cc2cccs2)CC2CCC1O2 |
| InChI | InChI=1S/C12H13NOS/c13-8-12(7-10-2-1-5-15-10)6-9-3-4-11(12)14-9/h1-2,5,9,11H,3-4,6-7H2 |
| InChIKey | DAQNBCNQZHZDCQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |