C13H17BrO2S — CID 65393457
1-[(5-bromothiophen-2-yl)methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 65393457) has the molecular formula C13H17BrO2S and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65393457 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(Cc2ccc(Br)s2)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H17BrO2S/c1-9-4-6-13(7-5-9,12(15)16)8-10-2-3-11(14)17-10/h2-3,9H,4-8H2,1H3,(H,15,16) |
| InChIKey | NFMYXHUABAOJNS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |