C9H9BrO2S — CID 66023531
1-[(5-bromothiophen-2-yl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 66023531) has the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 66023531 |
| Molecular Formula | C9H9BrO2S |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C9H9BrO2S/c10-7-2-1-6(13-7)5-9(3-4-9)8(11)12/h1-2H,3-5H2,(H,11,12) |
| InChIKey | AWJZFWAVULBGRK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |