C9H10BrNO3S — CID 115248278
3-[[(5-bromothiophen-2-yl)amino]methyl]oxetane-3-carboxylic acid (PubChem CID 115248278) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is 3-[[(5-bromothiophen-2-yl)amino]methyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[[(5-bromothiophen-2-yl)amino]methyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 115248278 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 3-[[(5-bromothiophen-2-yl)amino]methyl]oxetane-3-carboxylic acid |
| SMILES | O=C(O)C1(CNc2ccc(Br)s2)COC1 |
| InChI | InChI=1S/C9H10BrNO3S/c10-6-1-2-7(15-6)11-3-9(8(12)13)4-14-5-9/h1-2,11H,3-5H2,(H,12,13) |
| InChIKey | HQTLEUSQKQCKEC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |