C9H12BrNO2S — CID 115220505
4-[(5-bromothiophen-2-yl)amino]-2-methylbutanoic acid (PubChem CID 115220505) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)amino]-2-methylbutanoic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 115220505 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)amino]-2-methylbutanoic acid |
| SMILES | CC(CCNc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H12BrNO2S/c1-6(9(12)13)4-5-11-8-3-2-7(10)14-8/h2-3,6,11H,4-5H2,1H3,(H,12,13) |
| InChIKey | BPJPCKCMCZFWOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |