C9H10BrNO4S — CID 56992473
(2S)-2-[(5-bromothiophen-2-yl)amino]pentanedioic acid (PubChem CID 56992473) has the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. Its IUPAC name is (2S)-2-[(5-bromothiophen-2-yl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-bromothiophen-2-yl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 56992473 |
| Molecular Formula | C9H10BrNO4S |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | (2S)-2-[(5-bromothiophen-2-yl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](Nc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H10BrNO4S/c10-6-2-3-7(16-6)11-5(9(14)15)1-4-8(12)13/h2-3,5,11H,1,4H2,(H,12,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | XFKGZWJYZGFCFZ-YFKPBYRVSA-N |
| XLogP | 2.24 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |