2-methyl-4-(thiophen-2-ylamino)butanoic acid

C9H13NO2S — CID 115220490

IUPAC2-methyl-4-(thiophen-2-ylamino)butanoic acid
SMILESCC(CCNc1cccs1)C(=O)O
InChIInChI=1S/C9H13NO2S/c1-7(9(11)12)4-5-10-8-3-2-6-13-8/h2-3,6-7,10H,4-5H2,1H3,(H,11,12)
InChIKeyZUBRBMUOYYYAAC-UHFFFAOYSA-N
MW199.28 g/mol
LogP2.27
Rot. Bonds5

About 2-methyl-4-(thiophen-2-ylamino)butanoic acid

2-methyl-4-(thiophen-2-ylamino)butanoic acid (PubChem CID 115220490) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-methyl-4-(thiophen-2-ylamino)butanoic acid.

Molecular Properties

Compound Name2-methyl-4-(thiophen-2-ylamino)butanoic acid
PubChem CID115220490
Molecular FormulaC9H13NO2S
Molecular Weight199.28 g/mol
Exact Mass199.07
IUPAC Name2-methyl-4-(thiophen-2-ylamino)butanoic acid
SMILESCC(CCNc1cccs1)C(=O)O
InChIInChI=1S/C9H13NO2S/c1-7(9(11)12)4-5-10-8-3-2-6-13-8/h2-3,6-7,10H,4-5H2,1H3,(H,11,12)
InChIKeyZUBRBMUOYYYAAC-UHFFFAOYSA-N
XLogP2.27
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.28
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-methyl-4-(thiophen-2-ylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[(5-bromothiophen-2-yl)amino]-2-methylbutanoic acid
CID 115220505
(2S)-2-(methyldiazenyl)-5-(thiophen-2-ylamino)pentanoic acid
CID 54512826
2-methyl-4-(thiophen-2-ylmethylcarbamoylamino)butanoic acid
CID 80540659
2-methyl-4-(pyridin-4-ylamino)butanoic acid
CID 80539478
N-propylthiophen-2-amine;hydrochloride
CID 22714339
2-methyl-5-(1-thiophen-2-ylethylcarbamoylamino)pentanoic acid
CID 104686244
2-methyl-6-(thiophene-2-carbonylamino)heptanoic acid
CID 65285828
2-methyl-4-(naphthalen-1-ylamino)butanoic acid
CID 115220580
N-(2-phenylethyl)thiophen-2-amine
CID 68833245
2-methyl-5-[3-(thiophene-2-carbonylamino)propanoylamino]pentanoic acid
CID 104682695
4-[(3-bromothiophene-2-carbonyl)amino]-2-methylbutanoic acid
CID 80538498
4-[(3-ethylthiophene-2-carbonyl)amino]-2-methylbutanoic acid
CID 80539115

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-(thiophen-2-ylamino)butanoic acid?
The IUPAC name of 2-methyl-4-(thiophen-2-ylamino)butanoic acid (CID 115220490) is 2-methyl-4-(thiophen-2-ylamino)butanoic acid.
What is the SMILES notation for 2-methyl-4-(thiophen-2-ylamino)butanoic acid?
The canonical SMILES for 2-methyl-4-(thiophen-2-ylamino)butanoic acid is CC(CCNc1cccs1)C(=O)O.
What is the InChIKey of 2-methyl-4-(thiophen-2-ylamino)butanoic acid?
The InChIKey is ZUBRBMUOYYYAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-7(9(11)12)4-5-10-8-3-2-6-13-8/h2-3,6-7,10H,4-5H2,1H3,(H,11,12).
What are the key properties of 2-methyl-4-(thiophen-2-ylamino)butanoic acid?
2-methyl-4-(thiophen-2-ylamino)butanoic acid has a molecular weight of 199.28 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(thiophen-2-ylamino)butanoic acid is sourced from PubChem (CID 115220490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).