C10H15N3O2S — CID 54512826
(2S)-2-(methyldiazenyl)-5-(thiophen-2-ylamino)pentanoic acid (PubChem CID 54512826) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is (2S)-2-(methyldiazenyl)-5-(thiophen-2-ylamino)pentanoic acid.
| Compound Name | (2S)-2-(methyldiazenyl)-5-(thiophen-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 54512826 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2S)-2-(methyldiazenyl)-5-(thiophen-2-ylamino)pentanoic acid |
| SMILES | C/N=N/[C@@H](CCCNc1cccs1)C(=O)O |
| InChI | InChI=1S/C10H15N3O2S/c1-11-13-8(10(14)15)4-2-6-12-9-5-3-7-16-9/h3,5,7-8,12H,2,4,6H2,1H3,(H,14,15)/b13-11+/t8-/m0/s1 |
| InChIKey | YKIMXMGRWBGPNH-LVBPULCISA-N |
| XLogP | 2.48 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|