C12H21NOS — CID 65394038
3-(aminomethyl)-4-(5-ethylthiophen-2-yl)-3-methylbutan-2-ol (PubChem CID 65394038) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(5-ethylthiophen-2-yl)-3-methylbutan-2-ol.
| Compound Name | 3-(aminomethyl)-4-(5-ethylthiophen-2-yl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 65394038 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-(aminomethyl)-4-(5-ethylthiophen-2-yl)-3-methylbutan-2-ol |
| SMILES | CCc1ccc(CC(C)(CN)C(C)O)s1 |
| InChI | InChI=1S/C12H21NOS/c1-4-10-5-6-11(15-10)7-12(3,8-13)9(2)14/h5-6,9,14H,4,7-8,13H2,1-3H3 |
| InChIKey | IPGAQQLZIBVLRR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |