About 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol
1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol (PubChem CID 65394345) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol |
| PubChem CID | 65394345 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol |
| SMILES | CCC1CCC(C(O)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30O/c1-5-12-6-8-13(9-7-12)14(16)10-11-15(2,3)4/h12-14,16H,5-11H2,1-4H3 |
| InChIKey | ZYWFXCNKSFEIDB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol?
The IUPAC name of 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol (CID 65394345) is 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol is CCC1CCC(C(O)CCC(C)(C)C)CC1.
What is the InChIKey of 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol?
The InChIKey is ZYWFXCNKSFEIDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-5-12-6-8-13(9-7-12)14(16)10-11-15(2,3)4/h12-14,16H,5-11H2,1-4H3.
What are the key properties of 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol?
1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol has a molecular weight of 226.40 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylcyclohexyl)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 65394345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).