C15H13FN4O2S — CID 6539626
3-{[3-(4-fluorophenyl)-1H-pyrazol-5-yl]amino}benzene-1-sulfonamide (PubChem CID 6539626) has the molecular formula C15H13FN4O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[[5-(4-fluorophenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide.
| Compound Name | 3-{[3-(4-fluorophenyl)-1H-pyrazol-5-yl]amino}benzene-1-sulfonamide |
|---|---|
| PubChem CID | 6539626 |
| Molecular Formula | C15H13FN4O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[[5-(4-fluorophenyl)-1H-pyrazol-3-yl]amino]benzenesulfonamide |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)NC2=NNC(=C2)C3=CC=C(C=C3)F |
| InChI | InChI=1S/C15H13FN4O2S/c16-11-6-4-10(5-7-11)14-9-15(20-19-14)18-12-2-1-3-13(8-12)23(17,21)22/h1-9H,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | KTEUANCPUUWBLK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 490 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |