About 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea (PubChem CID 6540029) has the molecular formula C19H14ClN5OS
and a molecular weight of 395.88 g/mol. Its IUPAC name is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea |
| PubChem CID | 6540029 |
| Molecular Formula | C19H14ClN5OS |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea |
| SMILES | Nc1ncnc2scc(-c3ccc(NC(=O)Nc4cccc(Cl)c4)cc3)c12 |
| InChI | InChI=1S/C19H14ClN5OS/c20-12-2-1-3-14(8-12)25-19(26)24-13-6-4-11(5-7-13)15-9-27-18-16(15)17(21)22-10-23-18/h1-10H,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | WALBWDUVJYSLBL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea?
The IUPAC name of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea (CID 6540029) is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea.
What is the SMILES notation for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea?
The canonical SMILES for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea is Nc1ncnc2scc(-c3ccc(NC(=O)Nc4cccc(Cl)c4)cc3)c12.
What is the InChIKey of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea?
The InChIKey is WALBWDUVJYSLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN5OS/c20-12-2-1-3-14(8-12)25-19(26)24-13-6-4-11(5-7-13)15-9-27-18-16(15)17(21)22-10-23-18/h1-10H,(H2,21,22,23)(H2,24,25,26).
What are the key properties of 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea?
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea has a molecular weight of 395.88 g/mol, XLogP of 5.24, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-chlorophenyl)urea is sourced from PubChem (CID 6540029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).