C16H20BrFO2 — CID 65401281
1-[(2-bromo-4-fluorophenyl)methyl]-3-ethylcyclohexane-1-carboxylic acid (PubChem CID 65401281) has the molecular formula C16H20BrFO2 and a molecular weight of 343.24 g/mol. Its IUPAC name is 1-[(2-bromo-4-fluorophenyl)methyl]-3-ethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(2-bromo-4-fluorophenyl)methyl]-3-ethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65401281 |
| Molecular Formula | C16H20BrFO2 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[(2-bromo-4-fluorophenyl)methyl]-3-ethylcyclohexane-1-carboxylic acid |
| SMILES | CCC1CCCC(Cc2ccc(F)cc2Br)(C(=O)O)C1 |
| InChI | InChI=1S/C16H20BrFO2/c1-2-11-4-3-7-16(9-11,15(19)20)10-12-5-6-13(18)8-14(12)17/h5-6,8,11H,2-4,7,9-10H2,1H3,(H,19,20) |
| InChIKey | KAHXRYPFANACOS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |