C16H19N3O — CID 65406387
2-(3,4-dihydro-2H-chromen-3-yl)-N-propylpyrimidin-4-amine (PubChem CID 65406387) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-3-yl)-N-propylpyrimidin-4-amine.
| Compound Name | 2-(3,4-dihydro-2H-chromen-3-yl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 65406387 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-3-yl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ccnc(C2COc3ccccc3C2)n1 |
| InChI | InChI=1S/C16H19N3O/c1-2-8-17-15-7-9-18-16(19-15)13-10-12-5-3-4-6-14(12)20-11-13/h3-7,9,13H,2,8,10-11H2,1H3,(H,17,18,19) |
| InChIKey | UVVXXXFIIBTOLF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |