C17H21N3O — CID 65410111
3-[3,4-dihydro-2H-chromen-3-yl(ethylamino)methyl]pyridin-2-amine (PubChem CID 65410111) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-[3,4-dihydro-2H-chromen-3-yl(ethylamino)methyl]pyridin-2-amine.
| Compound Name | 3-[3,4-dihydro-2H-chromen-3-yl(ethylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65410111 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[3,4-dihydro-2H-chromen-3-yl(ethylamino)methyl]pyridin-2-amine |
| SMILES | CCNC(c1cccnc1N)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H21N3O/c1-2-19-16(14-7-5-9-20-17(14)18)13-10-12-6-3-4-8-15(12)21-11-13/h3-9,13,16,19H,2,10-11H2,1H3,(H2,18,20) |
| InChIKey | PUFPJISMQDEWCZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |