C11H10N4O — CID 65416219
2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzonitrile (PubChem CID 65416219) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzonitrile.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 65416219 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzonitrile |
| SMILES | Cn1ncnc1COc1ccccc1C#N |
| InChI | InChI=1S/C11H10N4O/c1-15-11(13-8-14-15)7-16-10-5-3-2-4-9(10)6-12/h2-5,8H,7H2,1H3 |
| InChIKey | HKQLCPGTMFKNTG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |