C18H35N — CID 65424912
(3,5-dimethylcyclohexyl)-(4-propylcyclohexyl)methanamine (PubChem CID 65424912) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(4-propylcyclohexyl)methanamine.
| Compound Name | (3,5-dimethylcyclohexyl)-(4-propylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 65424912 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(4-propylcyclohexyl)methanamine |
| SMILES | CCCC1CCC(C(N)C2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C18H35N/c1-4-5-15-6-8-16(9-7-15)18(19)17-11-13(2)10-14(3)12-17/h13-18H,4-12,19H2,1-3H3 |
| InChIKey | RIAAWFDIQJIXBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |