C13H14O2 — CID 65426315
1-(4,6-dimethyl-1-benzofuran-2-yl)propan-1-one (PubChem CID 65426315) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1-benzofuran-2-yl)propan-1-one.
| Compound Name | 1-(4,6-dimethyl-1-benzofuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 65426315 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-(4,6-dimethyl-1-benzofuran-2-yl)propan-1-one |
| SMILES | CCC(=O)c1cc2c(C)cc(C)cc2o1 |
| InChI | InChI=1S/C13H14O2/c1-4-11(14)13-7-10-9(3)5-8(2)6-12(10)15-13/h5-7H,4H2,1-3H3 |
| InChIKey | KLGHWRRSIWOTGG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |