C17H22BrNS — CID 65429324
N-[3-(4-bromothiophen-2-yl)-2-phenylpropyl]-2-methylpropan-1-amine (PubChem CID 65429324) has the molecular formula C17H22BrNS and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[3-(4-bromothiophen-2-yl)-2-phenylpropyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(4-bromothiophen-2-yl)-2-phenylpropyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 65429324 |
| Molecular Formula | C17H22BrNS |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[3-(4-bromothiophen-2-yl)-2-phenylpropyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC(Cc1cc(Br)cs1)c1ccccc1 |
| InChI | InChI=1S/C17H22BrNS/c1-13(2)10-19-11-15(14-6-4-3-5-7-14)8-17-9-16(18)12-20-17/h3-7,9,12-13,15,19H,8,10-11H2,1-2H3 |
| InChIKey | YJXNXLBHBYIIEE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |