C16H19Br2NOS — CID 79431151
2-(3-bromophenyl)-3-(4-bromothiophen-2-yl)-N-(2-methoxyethyl)propan-1-amine (PubChem CID 79431151) has the molecular formula C16H19Br2NOS and a molecular weight of 433.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(4-bromothiophen-2-yl)-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 2-(3-bromophenyl)-3-(4-bromothiophen-2-yl)-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 79431151 |
| Molecular Formula | C16H19Br2NOS |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 2-(3-bromophenyl)-3-(4-bromothiophen-2-yl)-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCC(Cc1cc(Br)cs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H19Br2NOS/c1-20-6-5-19-10-13(8-16-9-15(18)11-21-16)12-3-2-4-14(17)7-12/h2-4,7,9,11,13,19H,5-6,8,10H2,1H3 |
| InChIKey | JHSVHVJWLOVMSV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|