C14H14N2O2 — CID 65430258
4-hydroxy-2-(2-methylcyclopropyl)-5-phenyl-1H-pyrimidin-6-one (PubChem CID 65430258) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-hydroxy-2-(2-methylcyclopropyl)-5-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-(2-methylcyclopropyl)-5-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 65430258 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-hydroxy-2-(2-methylcyclopropyl)-5-phenyl-1H-pyrimidin-6-one |
| SMILES | CC1CC1c1nc(O)c(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N2O2/c1-8-7-10(8)12-15-13(17)11(14(18)16-12)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | PNTPYISXJLAYRE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |