C15H15ClN2O3 — CID 82840255
5-(3-chlorophenyl)-4-hydroxy-2-(5-methyloxolan-2-yl)-1H-pyrimidin-6-one (PubChem CID 82840255) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4-hydroxy-2-(5-methyloxolan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-chlorophenyl)-4-hydroxy-2-(5-methyloxolan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 82840255 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(3-chlorophenyl)-4-hydroxy-2-(5-methyloxolan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CC1CCC(c2nc(O)c(-c3cccc(Cl)c3)c(=O)[nH]2)O1 |
| InChI | InChI=1S/C15H15ClN2O3/c1-8-5-6-11(21-8)13-17-14(19)12(15(20)18-13)9-3-2-4-10(16)7-9/h2-4,7-8,11H,5-6H2,1H3,(H2,17,18,19,20) |
| InChIKey | NKCXZXYAQZTOGS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |