C11H16FNO2 — CID 65434086
3-amino-1-(2-fluoro-6-methoxyphenyl)-2-methylpropan-1-ol (PubChem CID 65434086) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-amino-1-(2-fluoro-6-methoxyphenyl)-2-methylpropan-1-ol.
| Compound Name | 3-amino-1-(2-fluoro-6-methoxyphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 65434086 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-amino-1-(2-fluoro-6-methoxyphenyl)-2-methylpropan-1-ol |
| SMILES | COc1cccc(F)c1C(O)C(C)CN |
| InChI | InChI=1S/C11H16FNO2/c1-7(6-13)11(14)10-8(12)4-3-5-9(10)15-2/h3-5,7,11,14H,6,13H2,1-2H3 |
| InChIKey | HNHGFRBDUXQLFN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |