C11H19N3 — CID 65440079
N-methyl-5,6-di(propan-2-yl)pyrimidin-4-amine (PubChem CID 65440079) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-methyl-5,6-di(propan-2-yl)pyrimidin-4-amine.
| Compound Name | N-methyl-5,6-di(propan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 65440079 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-methyl-5,6-di(propan-2-yl)pyrimidin-4-amine |
| SMILES | CNc1ncnc(C(C)C)c1C(C)C |
| InChI | InChI=1S/C11H19N3/c1-7(2)9-10(8(3)4)13-6-14-11(9)12-5/h6-8H,1-5H3,(H,12,13,14) |
| InChIKey | WUMIJKZLQJKVHQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |