C13H22N2O4S — CID 65443743
2-[1-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid (PubChem CID 65443743) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[1-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443743 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-[1-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid |
| SMILES | CN1CCN(C(=O)CS(=O)CC2(CC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C13H22N2O4S/c1-14-4-6-15(7-5-14)11(16)9-20(19)10-13(2-3-13)8-12(17)18/h2-10H2,1H3,(H,17,18) |
| InChIKey | QJLZZPQEMHKHDF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |