C13H16O3S — CID 65444144
2-[1-(benzylsulfinylmethyl)cyclopropyl]acetic acid (PubChem CID 65444144) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-[1-(benzylsulfinylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(benzylsulfinylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65444144 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[1-(benzylsulfinylmethyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H16O3S/c14-12(15)8-13(6-7-13)10-17(16)9-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,14,15) |
| InChIKey | XMVZXKXGJDFPTK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |