C11H13BrO3S2 — CID 65442553
2-[1-[(3-bromothiophen-2-yl)methylsulfinylmethyl]cyclopropyl]acetic acid (PubChem CID 65442553) has the molecular formula C11H13BrO3S2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-[1-[(3-bromothiophen-2-yl)methylsulfinylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(3-bromothiophen-2-yl)methylsulfinylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65442553 |
| Molecular Formula | C11H13BrO3S2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2-[1-[(3-bromothiophen-2-yl)methylsulfinylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)Cc2sccc2Br)CC1 |
| InChI | InChI=1S/C11H13BrO3S2/c12-8-1-4-16-9(8)6-17(15)7-11(2-3-11)5-10(13)14/h1,4H,2-3,5-7H2,(H,13,14) |
| InChIKey | JLDOPLVBTWAYAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |