C15H18O3S — CID 116517936
2-[1-[(2-phenylcyclopropyl)sulfinylmethyl]cyclopropyl]acetic acid (PubChem CID 116517936) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[1-[(2-phenylcyclopropyl)sulfinylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(2-phenylcyclopropyl)sulfinylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 116517936 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[1-[(2-phenylcyclopropyl)sulfinylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)C2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C15H18O3S/c16-14(17)9-15(6-7-15)10-19(18)13-8-12(13)11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,16,17) |
| InChIKey | LCNZHHSLZBTZLI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |