C15H19NO4S — CID 65444342
2-[1-[[2-(benzylamino)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid (PubChem CID 65444342) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[1-[[2-(benzylamino)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[2-(benzylamino)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65444342 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[1-[[2-(benzylamino)-2-oxoethyl]sulfinylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)CC(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H19NO4S/c17-13(16-9-12-4-2-1-3-5-12)10-21(20)11-15(6-7-15)8-14(18)19/h1-5H,6-11H2,(H,16,17)(H,18,19) |
| InChIKey | AJZITNPYTYWBQO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |