C14H16BrFO3S — CID 107777949
methyl 2-[1-[(2-bromo-4-fluorophenyl)methylsulfinylmethyl]cyclopropyl]acetate (PubChem CID 107777949) has the molecular formula C14H16BrFO3S and a molecular weight of 363.25 g/mol. Its IUPAC name is methyl 2-[1-[(2-bromo-4-fluorophenyl)methylsulfinylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(2-bromo-4-fluorophenyl)methylsulfinylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777949 |
| Molecular Formula | C14H16BrFO3S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | methyl 2-[1-[(2-bromo-4-fluorophenyl)methylsulfinylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)Cc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C14H16BrFO3S/c1-19-13(17)7-14(4-5-14)9-20(18)8-10-2-3-11(16)6-12(10)15/h2-3,6H,4-5,7-9H2,1H3 |
| InChIKey | TWSUSLIATUFNRY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |