C15H19NO4S — CID 107777756
methyl 2-[1-[(2-carbamoylphenyl)methylsulfinylmethyl]cyclopropyl]acetate (PubChem CID 107777756) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 2-[1-[(2-carbamoylphenyl)methylsulfinylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(2-carbamoylphenyl)methylsulfinylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777756 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 2-[1-[(2-carbamoylphenyl)methylsulfinylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)Cc2ccccc2C(N)=O)CC1 |
| InChI | InChI=1S/C15H19NO4S/c1-20-13(17)8-15(6-7-15)10-21(19)9-11-4-2-3-5-12(11)14(16)18/h2-5H,6-10H2,1H3,(H2,16,18) |
| InChIKey | SZDGULIVUNBYDF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |