C16H15BrFNO2S — CID 42953973
2-[(2-bromo-4-fluorophenyl)methylsulfinyl]-N-(4-methylphenyl)acetamide (PubChem CID 42953973) has the molecular formula C16H15BrFNO2S and a molecular weight of 384.27 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methylsulfinyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methylsulfinyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 42953973 |
| Molecular Formula | C16H15BrFNO2S |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methylsulfinyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CS(=O)Cc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C16H15BrFNO2S/c1-11-2-6-14(7-3-11)19-16(20)10-22(21)9-12-4-5-13(18)8-15(12)17/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | VUQDCZGYAGSHMS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |