C14H29NO3 — CID 65448217
N-(1,1-dimethoxypropan-2-yl)nonanamide (PubChem CID 65448217) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)nonanamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)nonanamide |
|---|---|
| PubChem CID | 65448217 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)nonanamide |
| SMILES | CCCCCCCCC(=O)NC(C)C(OC)OC |
| InChI | InChI=1S/C14H29NO3/c1-5-6-7-8-9-10-11-13(16)15-12(2)14(17-3)18-4/h12,14H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | CBBIMADULYFKNJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|