C9H8N4O2S — CID 65462227
5-(5-methyl-2-nitrophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 65462227) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 5-(5-methyl-2-nitrophenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(5-methyl-2-nitrophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 65462227 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5-(5-methyl-2-nitrophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc([N+](=O)[O-])c(-c2nc(=S)[nH][nH]2)c1 |
| InChI | InChI=1S/C9H8N4O2S/c1-5-2-3-7(13(14)15)6(4-5)8-10-9(16)12-11-8/h2-4H,1H3,(H2,10,11,12,16) |
| InChIKey | HQFCHTNRSDNTFG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|