C13H12N2O6 — CID 114373878
4-(methoxymethyl)-2-(5-methyl-2-nitrophenyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114373878) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(5-methyl-2-nitrophenyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 4-(methoxymethyl)-2-(5-methyl-2-nitrophenyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114373878 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-(methoxymethyl)-2-(5-methyl-2-nitrophenyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | COCc1nc(-c2cc(C)ccc2[N+](=O)[O-])oc1C(=O)O |
| InChI | InChI=1S/C13H12N2O6/c1-7-3-4-10(15(18)19)8(5-7)12-14-9(6-20-2)11(21-12)13(16)17/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | BZMWXOLLNAJXLN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|