C12H8F2N2O5 — CID 104842474
2-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid (PubChem CID 104842474) has the molecular formula C12H8F2N2O5 and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 104842474 |
| Molecular Formula | C12H8F2N2O5 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
| SMILES | CCc1nc(-c2cc(F)c(F)cc2[N+](=O)[O-])oc1C(=O)O |
| InChI | InChI=1S/C12H8F2N2O5/c1-2-8-10(12(17)18)21-11(15-8)5-3-6(13)7(14)4-9(5)16(19)20/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | IARGGLRQAMHIOT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|