C12H9ClN2O5 — CID 104842442
2-(3-chloro-5-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid (PubChem CID 104842442) has the molecular formula C12H9ClN2O5 and a molecular weight of 296.67 g/mol. Its IUPAC name is 2-(3-chloro-5-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(3-chloro-5-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 104842442 |
| Molecular Formula | C12H9ClN2O5 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-(3-chloro-5-nitrophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
| SMILES | CCc1nc(-c2cc(Cl)cc([N+](=O)[O-])c2)oc1C(=O)O |
| InChI | InChI=1S/C12H9ClN2O5/c1-2-9-10(12(16)17)20-11(14-9)6-3-7(13)5-8(4-6)15(18)19/h3-5H,2H2,1H3,(H,16,17) |
| InChIKey | BPMBAHXOJGOAHL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|