C10H4F2N2O5 — CID 62235219
2-(4,5-difluoro-2-nitrophenyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 62235219) has the molecular formula C10H4F2N2O5 and a molecular weight of 270.15 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-nitrophenyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4,5-difluoro-2-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62235219 |
| Molecular Formula | C10H4F2N2O5 |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-(4,5-difluoro-2-nitrophenyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-c2cc(F)c(F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H4F2N2O5/c11-5-1-4(8(14(17)18)2-6(5)12)9-13-7(3-19-9)10(15)16/h1-3H,(H,15,16) |
| InChIKey | AQDKMFNXRKTTKH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|