C18H21NO3 — CID 6546229
(3R)-3-(furan-2-yl)-3-(4-methylphenyl)-1-morpholin-4-ylpropan-1-one (PubChem CID 6546229) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-1-morpholin-4-ylpropan-1-one.
| Compound Name | (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 6546229 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3R)-3-(furan-2-yl)-3-(4-methylphenyl)-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1ccc([C@@H](CC(=O)N2CCOCC2)c2ccco2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-14-4-6-15(7-5-14)16(17-3-2-10-22-17)13-18(20)19-8-11-21-12-9-19/h2-7,10,16H,8-9,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | AFBWAJQRQKNZTG-MRXNPFEDSA-N |
| XLogP | 2.97 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |