C16H22N4O — CID 65462769
N-(4-cyanophenyl)-3-(2,2-dimethylpiperazin-1-yl)propanamide (PubChem CID 65462769) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(2,2-dimethylpiperazin-1-yl)propanamide.
| Compound Name | N-(4-cyanophenyl)-3-(2,2-dimethylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 65462769 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-(4-cyanophenyl)-3-(2,2-dimethylpiperazin-1-yl)propanamide |
| SMILES | CC1(C)CNCCN1CCC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-16(2)12-18-8-10-20(16)9-7-15(21)19-14-5-3-13(11-17)4-6-14/h3-6,18H,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | QZWNQEDNIQPCGD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |