C15H17BrN2O2S — CID 65467533
1-N-(4-bromo-2,6-dimethylphenyl)-4-methylsulfonylbenzene-1,2-diamine (PubChem CID 65467533) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is 1-N-(4-bromo-2,6-dimethylphenyl)-4-methylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-(4-bromo-2,6-dimethylphenyl)-4-methylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 65467533 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-N-(4-bromo-2,6-dimethylphenyl)-4-methylsulfonylbenzene-1,2-diamine |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C15H17BrN2O2S/c1-9-6-11(16)7-10(2)15(9)18-14-5-4-12(8-13(14)17)21(3,19)20/h4-8,18H,17H2,1-3H3 |
| InChIKey | ZXJAZWLDRRHGBR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|