C13H18F2N2O — CID 65472075
3,5-difluoro-4-[(1-methylpiperidin-2-yl)methoxy]aniline (PubChem CID 65472075) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,5-difluoro-4-[(1-methylpiperidin-2-yl)methoxy]aniline.
| Compound Name | 3,5-difluoro-4-[(1-methylpiperidin-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 65472075 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3,5-difluoro-4-[(1-methylpiperidin-2-yl)methoxy]aniline |
| SMILES | CN1CCCCC1COc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-17-5-3-2-4-10(17)8-18-13-11(14)6-9(16)7-12(13)15/h6-7,10H,2-5,8,16H2,1H3 |
| InChIKey | IEEOKKLZEQSHEE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|