C10H9ClF3N3OS — CID 65473699
5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 65473699) has the molecular formula C10H9ClF3N3OS and a molecular weight of 311.72 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65473699 |
| Molecular Formula | C10H9ClF3N3OS |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 5-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | FC(F)(F)COCCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C10H9ClF3N3OS/c11-6-1-2-7-9(17-19-16-7)8(6)15-3-4-18-5-10(12,13)14/h1-2,15H,3-5H2 |
| InChIKey | SMNCJGDPQWNSPI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|