C12H17ClN2O3S — CID 65474202
methyl 2-acetamido-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoate (PubChem CID 65474202) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is methyl 2-acetamido-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoate.
| Compound Name | methyl 2-acetamido-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoate |
|---|---|
| PubChem CID | 65474202 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 2-acetamido-3-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoate |
| SMILES | COC(=O)C(CN(C)Cc1ccc(Cl)s1)NC(C)=O |
| InChI | InChI=1S/C12H17ClN2O3S/c1-8(16)14-10(12(17)18-3)7-15(2)6-9-4-5-11(13)19-9/h4-5,10H,6-7H2,1-3H3,(H,14,16) |
| InChIKey | GMELTRGUHSAPQY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |