C14H16BrNO2S2 — CID 65479835
4-(bromomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide (PubChem CID 65479835) has the molecular formula C14H16BrNO2S2 and a molecular weight of 374.33 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 65479835 |
| Molecular Formula | C14H16BrNO2S2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 4-(bromomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(Cc1ccsc1)NS(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H16BrNO2S2/c1-11(8-13-6-7-19-10-13)16-20(17,18)14-4-2-12(9-15)3-5-14/h2-7,10-11,16H,8-9H2,1H3 |
| InChIKey | RAMVOYDHMMCJNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|