C14H18N2O2S2 — CID 106053233
2-(aminomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide (PubChem CID 106053233) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106053233 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(aminomethyl)-N-(1-thiophen-3-ylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(Cc1ccsc1)NS(=O)(=O)c1ccccc1CN |
| InChI | InChI=1S/C14H18N2O2S2/c1-11(8-12-6-7-19-10-12)16-20(17,18)14-5-3-2-4-13(14)9-15/h2-7,10-11,16H,8-9,15H2,1H3 |
| InChIKey | FOUKIJKAZMRFFE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |