C12H15N3O2S2 — CID 103305478
3-amino-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-sulfonamide (PubChem CID 103305478) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-amino-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-sulfonamide.
| Compound Name | 3-amino-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305478 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-amino-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-sulfonamide |
| SMILES | CC(Cc1ccsc1)NS(=O)(=O)c1ncccc1N |
| InChI | InChI=1S/C12H15N3O2S2/c1-9(7-10-4-6-18-8-10)15-19(16,17)12-11(13)3-2-5-14-12/h2-6,8-9,15H,7,13H2,1H3 |
| InChIKey | XNXAKFJWSTUSMB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |